C20H28N4O5 — CID 29139197
(2R)-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]-2-(5-methoxy-1H-indol-3-yl)acetic acid (PubChem CID 29139197) has the molecular formula C20H28N4O5 and a molecular weight of 404.47 g/mol. Its IUPAC name is (2R)-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]-2-(5-methoxy-1H-indol-3-yl)acetic acid.
| Compound Name | (2R)-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]-2-(5-methoxy-1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 29139197 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (2R)-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]-2-(5-methoxy-1H-indol-3-yl)acetic acid |
| SMILES | COCCNC(=O)CN1CCN([C@@H](C(=O)O)c2c[nH]c3ccc(OC)cc23)CC1 |
| InChI | InChI=1S/C20H28N4O5/c1-28-10-5-21-18(25)13-23-6-8-24(9-7-23)19(20(26)27)16-12-22-17-4-3-14(29-2)11-15(16)17/h3-4,11-12,19,22H,5-10,13H2,1-2H3,(H,21,25)(H,26,27)/t19-/m1/s1 |
| InChIKey | SWFDUZRMOXEXCU-LJQANCHMSA-N |
| XLogP | 0.68 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|