C25H26N4O3 — CID 42654111
2-(5-methoxy-1H-indol-3-yl)-2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]acetic acid (PubChem CID 42654111) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-(5-methoxy-1H-indol-3-yl)-2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]acetic acid.
| Compound Name | 2-(5-methoxy-1H-indol-3-yl)-2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 42654111 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-(5-methoxy-1H-indol-3-yl)-2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]acetic acid |
| SMILES | COc1ccc2[nH]cc(C(C(=O)O)N3CCN(c4cc(C)c5ccccc5n4)CC3)c2c1 |
| InChI | InChI=1S/C25H26N4O3/c1-16-13-23(27-22-6-4-3-5-18(16)22)28-9-11-29(12-10-28)24(25(30)31)20-15-26-21-8-7-17(32-2)14-19(20)21/h3-8,13-15,24,26H,9-12H2,1-2H3,(H,30,31) |
| InChIKey | BRSJYZIMEDSRGM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |