C22H25N3O5S — CID 42653902
2-(4-methylsulfonylpiperazin-1-yl)-2-(6-phenylmethoxy-1H-indol-3-yl)acetic acid (PubChem CID 42653902) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-(4-methylsulfonylpiperazin-1-yl)-2-(6-phenylmethoxy-1H-indol-3-yl)acetic acid.
| Compound Name | 2-(4-methylsulfonylpiperazin-1-yl)-2-(6-phenylmethoxy-1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 42653902 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-(4-methylsulfonylpiperazin-1-yl)-2-(6-phenylmethoxy-1H-indol-3-yl)acetic acid |
| SMILES | CS(=O)(=O)N1CCN(C(C(=O)O)c2c[nH]c3cc(OCc4ccccc4)ccc23)CC1 |
| InChI | InChI=1S/C22H25N3O5S/c1-31(28,29)25-11-9-24(10-12-25)21(22(26)27)19-14-23-20-13-17(7-8-18(19)20)30-15-16-5-3-2-4-6-16/h2-8,13-14,21,23H,9-12,15H2,1H3,(H,26,27) |
| InChIKey | NYJJVVFNMRZYHV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |