C14H8Cl2FN5O — CID 29129325
N-(2,5-dichlorophenyl)-4-fluoro-2-(tetrazol-1-yl)benzamide (PubChem CID 29129325) has the molecular formula C14H8Cl2FN5O and a molecular weight of 352.16 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-fluoro-2-(tetrazol-1-yl)benzamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-fluoro-2-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 29129325 |
| Molecular Formula | C14H8Cl2FN5O |
| Molecular Weight | 352.16 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-fluoro-2-(tetrazol-1-yl)benzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)c1ccc(F)cc1-n1cnnn1 |
| InChI | InChI=1S/C14H8Cl2FN5O/c15-8-1-4-11(16)12(5-8)19-14(23)10-3-2-9(17)6-13(10)22-7-18-20-21-22/h1-7H,(H,19,23) |
| InChIKey | JUWOONLOONUVKR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |