C20H24F2N4O3 — CID 29131345
methyl (2S,3R)-2-[[(4R)-4-(2,5-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-3-methylpentanoate (PubChem CID 29131345) has the molecular formula C20H24F2N4O3 and a molecular weight of 406.43 g/mol. Its IUPAC name is methyl (2S,3R)-2-[[(4R)-4-(2,5-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-3-methylpentanoate.
| Compound Name | methyl (2S,3R)-2-[[(4R)-4-(2,5-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 29131345 |
| Molecular Formula | C20H24F2N4O3 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | methyl (2S,3R)-2-[[(4R)-4-(2,5-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@H](NC(=O)N1CCc2[nH]cnc2[C@H]1c1cc(F)ccc1F)C(=O)OC |
| InChI | InChI=1S/C20H24F2N4O3/c1-4-11(2)16(19(27)29-3)25-20(28)26-8-7-15-17(24-10-23-15)18(26)13-9-12(21)5-6-14(13)22/h5-6,9-11,16,18H,4,7-8H2,1-3H3,(H,23,24)(H,25,28)/t11-,16+,18-/m1/s1 |
| InChIKey | UBWJAGVBILKOBT-DPZKZMLUSA-N |
| XLogP | 2.93 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |