C19H22F2N4O3S — CID 51819682
methyl (2R)-2-[[(4R)-4-(2,5-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylsulfanylbutanoate (PubChem CID 51819682) has the molecular formula C19H22F2N4O3S and a molecular weight of 424.47 g/mol. Its IUPAC name is methyl (2R)-2-[[(4R)-4-(2,5-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2R)-2-[[(4R)-4-(2,5-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 51819682 |
| Molecular Formula | C19H22F2N4O3S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | methyl (2R)-2-[[(4R)-4-(2,5-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@@H](CCSC)NC(=O)N1CCc2[nH]cnc2[C@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C19H22F2N4O3S/c1-28-18(26)15(6-8-29-2)24-19(27)25-7-5-14-16(23-10-22-14)17(25)12-9-11(20)3-4-13(12)21/h3-4,9-10,15,17H,5-8H2,1-2H3,(H,22,23)(H,24,27)/t15-,17-/m1/s1 |
| InChIKey | LEQYEYCENSRTNN-NVXWUHKLSA-N |
| XLogP | 2.64 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |