C20H23F3N4O3 — CID 29135537
methyl (2S)-4-methyl-2-[[(4R)-4-(2,3,4-trifluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]pentanoate (PubChem CID 29135537) has the molecular formula C20H23F3N4O3 and a molecular weight of 424.42 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[[(4R)-4-(2,3,4-trifluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-[[(4R)-4-(2,3,4-trifluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 29135537 |
| Molecular Formula | C20H23F3N4O3 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | methyl (2S)-4-methyl-2-[[(4R)-4-(2,3,4-trifluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)N1CCc2[nH]cnc2[C@H]1c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H23F3N4O3/c1-10(2)8-14(19(28)30-3)26-20(29)27-7-6-13-17(25-9-24-13)18(27)11-4-5-12(21)16(23)15(11)22/h4-5,9-10,14,18H,6-8H2,1-3H3,(H,24,25)(H,26,29)/t14-,18+/m0/s1 |
| InChIKey | PYFMREOTJIPHOB-KBXCAEBGSA-N |
| XLogP | 3.07 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|