C20H24F2N4O3 — CID 51809003
methyl (2R)-2-[[(4R)-4-(2,3-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylpentanoate (PubChem CID 51809003) has the molecular formula C20H24F2N4O3 and a molecular weight of 406.43 g/mol. Its IUPAC name is methyl (2R)-2-[[(4R)-4-(2,3-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[[(4R)-4-(2,3-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 51809003 |
| Molecular Formula | C20H24F2N4O3 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | methyl (2R)-2-[[(4R)-4-(2,3-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)N1CCc2[nH]cnc2[C@H]1c1cccc(F)c1F |
| InChI | InChI=1S/C20H24F2N4O3/c1-11(2)9-15(19(27)29-3)25-20(28)26-8-7-14-17(24-10-23-14)18(26)12-5-4-6-13(21)16(12)22/h4-6,10-11,15,18H,7-9H2,1-3H3,(H,23,24)(H,25,28)/t15-,18-/m1/s1 |
| InChIKey | PDDDBRXNJCXHCA-CRAIPNDOSA-N |
| XLogP | 2.93 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |