C19H19F3N4O5 — CID 39038841
dimethyl (2S)-2-[[(4S)-4-(2,3,4-trifluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]butanedioate (PubChem CID 39038841) has the molecular formula C19H19F3N4O5 and a molecular weight of 440.38 g/mol. Its IUPAC name is dimethyl (2S)-2-[[(4S)-4-(2,3,4-trifluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]butanedioate.
| Compound Name | dimethyl (2S)-2-[[(4S)-4-(2,3,4-trifluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]butanedioate |
|---|---|
| PubChem CID | 39038841 |
| Molecular Formula | C19H19F3N4O5 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | dimethyl (2S)-2-[[(4S)-4-(2,3,4-trifluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]butanedioate |
| SMILES | COC(=O)C[C@H](NC(=O)N1CCc2[nH]cnc2[C@@H]1c1ccc(F)c(F)c1F)C(=O)OC |
| InChI | InChI=1S/C19H19F3N4O5/c1-30-13(27)7-12(18(28)31-2)25-19(29)26-6-5-11-16(24-8-23-11)17(26)9-3-4-10(20)15(22)14(9)21/h3-4,8,12,17H,5-7H2,1-2H3,(H,23,24)(H,25,29)/t12-,17-/m0/s1 |
| InChIKey | MWVQTIUVCSEGKD-SJCJKPOMSA-N |
| XLogP | 1.59 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|