C21H28N4O5S — CID 51829887
methyl (2R)-2-[[(4R)-4-(2,3-dimethoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylsulfanylbutanoate (PubChem CID 51829887) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is methyl (2R)-2-[[(4R)-4-(2,3-dimethoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2R)-2-[[(4R)-4-(2,3-dimethoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 51829887 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | methyl (2R)-2-[[(4R)-4-(2,3-dimethoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@@H](CCSC)NC(=O)N1CCc2[nH]cnc2[C@H]1c1cccc(OC)c1OC |
| InChI | InChI=1S/C21H28N4O5S/c1-28-16-7-5-6-13(19(16)29-2)18-17-14(22-12-23-17)8-10-25(18)21(27)24-15(9-11-31-4)20(26)30-3/h5-7,12,15,18H,8-11H2,1-4H3,(H,22,23)(H,24,27)/t15-,18-/m1/s1 |
| InChIKey | SBXSDULAFLHQOV-CRAIPNDOSA-N |
| XLogP | 2.38 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |