C19H24N4O5 — CID 39378294
methyl 3-[[(4R)-4-(2,3-dimethoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]propanoate (PubChem CID 39378294) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is methyl 3-[[(4R)-4-(2,3-dimethoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[(4R)-4-(2,3-dimethoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 39378294 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | methyl 3-[[(4R)-4-(2,3-dimethoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)N1CCc2[nH]cnc2[C@H]1c1cccc(OC)c1OC |
| InChI | InChI=1S/C19H24N4O5/c1-26-14-6-4-5-12(18(14)28-3)17-16-13(21-11-22-16)8-10-23(17)19(25)20-9-7-15(24)27-2/h4-6,11,17H,7-10H2,1-3H3,(H,20,25)(H,21,22)/t17-/m1/s1 |
| InChIKey | YRFCKAIZVHKXLB-QGZVFWFLSA-N |
| XLogP | 1.65 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |