C19H24N4O4 — CID 42649054
methyl 4-[[4-(3-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]butanoate (PubChem CID 42649054) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is methyl 4-[[4-(3-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[4-(3-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 42649054 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | methyl 4-[[4-(3-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)N1CCc2[nH]cnc2C1c1cccc(OC)c1 |
| InChI | InChI=1S/C19H24N4O4/c1-26-14-6-3-5-13(11-14)18-17-15(21-12-22-17)8-10-23(18)19(25)20-9-4-7-16(24)27-2/h3,5-6,11-12,18H,4,7-10H2,1-2H3,(H,20,25)(H,21,22) |
| InChIKey | OGDMPWIUSPYXAT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|