About 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide
3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide (PubChem CID 29132941) has the molecular formula C16H21N3O2S
and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide |
| PubChem CID | 29132941 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide |
| SMILES | O=C(CCc1nnc(C2CCCCC2)o1)NCc1ccsc1 |
| InChI | InChI=1S/C16H21N3O2S/c20-14(17-10-12-8-9-22-11-12)6-7-15-18-19-16(21-15)13-4-2-1-3-5-13/h8-9,11,13H,1-7,10H2,(H,17,20) |
| InChIKey | FTQTVGSIMWGPQG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide?
The IUPAC name of 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide (CID 29132941) is 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide.
What is the SMILES notation for 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide?
The canonical SMILES for 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide is O=C(CCc1nnc(C2CCCCC2)o1)NCc1ccsc1.
What is the InChIKey of 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide?
The InChIKey is FTQTVGSIMWGPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2S/c20-14(17-10-12-8-9-22-11-12)6-7-15-18-19-16(21-15)13-4-2-1-3-5-13/h8-9,11,13H,1-7,10H2,(H,17,20).
What are the key properties of 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide?
3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide has a molecular weight of 319.43 g/mol, XLogP of 3.43, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-N-(thiophen-3-ylmethyl)propanamide is sourced from PubChem (CID 29132941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).