C17H21N3O3 — CID 86783941
3-(5-cyclopentyl-1,3,4-oxadiazol-2-yl)-N-(2-hydroxy-6-methylphenyl)propanamide (PubChem CID 86783941) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-(5-cyclopentyl-1,3,4-oxadiazol-2-yl)-N-(2-hydroxy-6-methylphenyl)propanamide.
| Compound Name | 3-(5-cyclopentyl-1,3,4-oxadiazol-2-yl)-N-(2-hydroxy-6-methylphenyl)propanamide |
|---|---|
| PubChem CID | 86783941 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-(5-cyclopentyl-1,3,4-oxadiazol-2-yl)-N-(2-hydroxy-6-methylphenyl)propanamide |
| SMILES | Cc1cccc(O)c1NC(=O)CCc1nnc(C2CCCC2)o1 |
| InChI | InChI=1S/C17H21N3O3/c1-11-5-4-8-13(21)16(11)18-14(22)9-10-15-19-20-17(23-15)12-6-2-3-7-12/h4-5,8,12,21H,2-3,6-7,9-10H2,1H3,(H,18,22) |
| InChIKey | WGXYJLNNQPNSEX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|