About N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide
N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide (PubChem CID 29133226) has the molecular formula C16H14ClN3OS
and a molecular weight of 331.83 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide |
| PubChem CID | 29133226 |
| Molecular Formula | C16H14ClN3OS |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide |
| SMILES | O=C(Cc1cnc(-n2cccc2)s1)NCc1ccccc1Cl |
| InChI | InChI=1S/C16H14ClN3OS/c17-14-6-2-1-5-12(14)10-18-15(21)9-13-11-19-16(22-13)20-7-3-4-8-20/h1-8,11H,9-10H2,(H,18,21) |
| InChIKey | JHVBESPUIRCJJJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide?
The IUPAC name of N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide (CID 29133226) is N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide.
What is the SMILES notation for N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide?
The canonical SMILES for N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide is O=C(Cc1cnc(-n2cccc2)s1)NCc1ccccc1Cl.
What is the InChIKey of N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide?
The InChIKey is JHVBESPUIRCJJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3OS/c17-14-6-2-1-5-12(14)10-18-15(21)9-13-11-19-16(22-13)20-7-3-4-8-20/h1-8,11H,9-10H2,(H,18,21).
What are the key properties of N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide?
N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide has a molecular weight of 331.83 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chlorophenyl)methyl]-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)acetamide is sourced from PubChem (CID 29133226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).