C31H35N3O4 — CID 2913331
N-benzyl-1-(1H-indol-3-ylmethyl)-N-(2-phenylethyl)piperidin-4-amine;oxalic acid (PubChem CID 2913331) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is N-benzyl-1-(1H-indol-3-ylmethyl)-N-(2-phenylethyl)piperidin-4-amine;oxalic acid.
| Compound Name | N-benzyl-1-(1H-indol-3-ylmethyl)-N-(2-phenylethyl)piperidin-4-amine;oxalic acid |
|---|---|
| PubChem CID | 2913331 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | N-benzyl-1-(1H-indol-3-ylmethyl)-N-(2-phenylethyl)piperidin-4-amine;oxalic acid |
| SMILES | O=C(O)C(=O)O.c1ccc(CCN(Cc2ccccc2)C2CCN(Cc3c[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C29H33N3.C2H2O4/c1-3-9-24(10-4-1)15-20-32(22-25-11-5-2-6-12-25)27-16-18-31(19-17-27)23-26-21-30-29-14-8-7-13-28(26)29;3-1(4)2(5)6/h1-14,21,27,30H,15-20,22-23H2;(H,3,4)(H,5,6) |
| InChIKey | ITZJHBSMROBAKQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|