C18H13ClN4O3S — CID 29133657
3-(1,3-benzodioxol-5-yloxymethyl)-6-[(4-chlorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 29133657) has the molecular formula C18H13ClN4O3S and a molecular weight of 400.85 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yloxymethyl)-6-[(4-chlorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(1,3-benzodioxol-5-yloxymethyl)-6-[(4-chlorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 29133657 |
| Molecular Formula | C18H13ClN4O3S |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yloxymethyl)-6-[(4-chlorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Clc1ccc(Cc2nn3c(COc4ccc5c(c4)OCO5)nnc3s2)cc1 |
| InChI | InChI=1S/C18H13ClN4O3S/c19-12-3-1-11(2-4-12)7-17-22-23-16(20-21-18(23)27-17)9-24-13-5-6-14-15(8-13)26-10-25-14/h1-6,8H,7,9-10H2 |
| InChIKey | RZOXSKOSNDWTAG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |