C18H14N4O4S — CID 71304883
6-(1,3-benzodioxol-5-yl)-3-[(4-methoxyphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 71304883) has the molecular formula C18H14N4O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-3-[(4-methoxyphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-3-[(4-methoxyphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 71304883 |
| Molecular Formula | C18H14N4O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-3-[(4-methoxyphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COc1ccc(OCc2nnc3sc(-c4ccc5c(c4)OCO5)nn23)cc1 |
| InChI | InChI=1S/C18H14N4O4S/c1-23-12-3-5-13(6-4-12)24-9-16-19-20-18-22(16)21-17(27-18)11-2-7-14-15(8-11)26-10-25-14/h2-8H,9-10H2,1H3 |
| InChIKey | LLBAZSMWAGIVSF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |