C14H14N4O2S2 — CID 139029613
6-(1,3-benzodioxol-5-yl)-3-(propan-2-ylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 139029613) has the molecular formula C14H14N4O2S2 and a molecular weight of 334.43 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-3-(propan-2-ylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-3-(propan-2-ylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 139029613 |
| Molecular Formula | C14H14N4O2S2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-3-(propan-2-ylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CC(C)SCc1nnc2sc(-c3ccc4c(c3)OCO4)nn12 |
| InChI | InChI=1S/C14H14N4O2S2/c1-8(2)21-6-12-15-16-14-18(12)17-13(22-14)9-3-4-10-11(5-9)20-7-19-10/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | ZURCOQWZWLABOA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |