C11H11N5O3S2 — CID 138106526
6-(5-nitrofuran-2-yl)-3-(propan-2-ylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 138106526) has the molecular formula C11H11N5O3S2 and a molecular weight of 325.38 g/mol. Its IUPAC name is 6-(5-nitrofuran-2-yl)-3-(propan-2-ylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(5-nitrofuran-2-yl)-3-(propan-2-ylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 138106526 |
| Molecular Formula | C11H11N5O3S2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 6-(5-nitrofuran-2-yl)-3-(propan-2-ylsulfanylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CC(C)SCc1nnc2sc(-c3ccc([N+](=O)[O-])o3)nn12 |
| InChI | InChI=1S/C11H11N5O3S2/c1-6(2)20-5-8-12-13-11-15(8)14-10(21-11)7-3-4-9(19-7)16(17)18/h3-4,6H,5H2,1-2H3 |
| InChIKey | UWYOHQRNROFVAT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|