C9H8N6O3S — CID 56680160
N-ethyl-3-(5-nitrofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine (PubChem CID 56680160) has the molecular formula C9H8N6O3S and a molecular weight of 280.27 g/mol. Its IUPAC name is N-ethyl-3-(5-nitrofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine.
| Compound Name | N-ethyl-3-(5-nitrofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine |
|---|---|
| PubChem CID | 56680160 |
| Molecular Formula | C9H8N6O3S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | N-ethyl-3-(5-nitrofuran-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine |
| SMILES | CCNc1nn2c(-c3ccc([N+](=O)[O-])o3)nnc2s1 |
| InChI | InChI=1S/C9H8N6O3S/c1-2-10-8-13-14-7(11-12-9(14)19-8)5-3-4-6(18-5)15(16)17/h3-4H,2H2,1H3,(H,10,13) |
| InChIKey | LQCZQAQJVDWFRH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|