C19H23NO3S2 — CID 2913687
N-[2-(4-methylsulfanylphenoxy)cyclohexyl]benzenesulfonamide (PubChem CID 2913687) has the molecular formula C19H23NO3S2 and a molecular weight of 377.53 g/mol. Its IUPAC name is N-[2-(4-methylsulfanylphenoxy)cyclohexyl]benzenesulfonamide.
| Compound Name | N-[2-(4-methylsulfanylphenoxy)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2913687 |
| Molecular Formula | C19H23NO3S2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[2-(4-methylsulfanylphenoxy)cyclohexyl]benzenesulfonamide |
| SMILES | CSc1ccc(OC2CCCCC2NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO3S2/c1-24-16-13-11-15(12-14-16)23-19-10-6-5-9-18(19)20-25(21,22)17-7-3-2-4-8-17/h2-4,7-8,11-14,18-20H,5-6,9-10H2,1H3 |
| InChIKey | VYCWNEJVRUZLOC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |