C21H23N3OS — CID 29139696
1-(4-benzylpiperidin-1-yl)-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)ethanone (PubChem CID 29139696) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 29139696 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-(2-pyrrol-1-yl-1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(Cc1cnc(-n2cccc2)s1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N3OS/c25-20(15-19-16-22-21(26-19)24-10-4-5-11-24)23-12-8-18(9-13-23)14-17-6-2-1-3-7-17/h1-7,10-11,16,18H,8-9,12-15H2 |
| InChIKey | RETAJUHEOMAFQN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |