C9H18N2O3 — CID 2914177
N'-butan-2-yl-N-(3-hydroxypropyl)oxamide (PubChem CID 2914177) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is N'-butan-2-yl-N-(3-hydroxypropyl)oxamide.
| Compound Name | N'-butan-2-yl-N-(3-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 2914177 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | N'-butan-2-yl-N-(3-hydroxypropyl)oxamide |
| SMILES | CCC(C)NC(=O)C(=O)NCCCO |
| InChI | InChI=1S/C9H18N2O3/c1-3-7(2)11-9(14)8(13)10-5-4-6-12/h7,12H,3-6H2,1-2H3,(H,10,13)(H,11,14) |
| InChIKey | ANIJVCJYYINEAG-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|