C19H16BrN3O — CID 29146968
2-bromo-N-[(Z)-(1-prop-2-enylindol-3-yl)methylideneamino]benzamide (PubChem CID 29146968) has the molecular formula C19H16BrN3O and a molecular weight of 382.26 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-(1-prop-2-enylindol-3-yl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(Z)-(1-prop-2-enylindol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 29146968 |
| Molecular Formula | C19H16BrN3O |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-bromo-N-[(Z)-(1-prop-2-enylindol-3-yl)methylideneamino]benzamide |
| SMILES | C=CCn1cc(/C=N\NC(=O)c2ccccc2Br)c2ccccc21 |
| InChI | InChI=1S/C19H16BrN3O/c1-2-11-23-13-14(15-7-4-6-10-18(15)23)12-21-22-19(24)16-8-3-5-9-17(16)20/h2-10,12-13H,1,11H2,(H,22,24)/b21-12- |
| InChIKey | XTULRABJCOHAIR-MTJSOVHGSA-N |
| XLogP | 4.35 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|