C20H24N4O5 — CID 29148160
methyl (2S)-2-[[(4S)-4-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-3-methylbutanoate (PubChem CID 29148160) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is methyl (2S)-2-[[(4S)-4-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(4S)-4-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 29148160 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | methyl (2S)-2-[[(4S)-4-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)N1CCc2[nH]cnc2[C@@H]1c1ccc2c(c1)OCO2)C(C)C |
| InChI | InChI=1S/C20H24N4O5/c1-11(2)16(19(25)27-3)23-20(26)24-7-6-13-17(22-9-21-13)18(24)12-4-5-14-15(8-12)29-10-28-14/h4-5,8-9,11,16,18H,6-7,10H2,1-3H3,(H,21,22)(H,23,26)/t16-,18-/m0/s1 |
| InChIKey | WVVVCQKQAJITIP-WMZOPIPTSA-N |
| XLogP | 1.99 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |