C22H20N4O5 — CID 42648854
methyl 2-[[4-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]benzoate (PubChem CID 42648854) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is methyl 2-[[4-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[4-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 42648854 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | methyl 2-[[4-(1,3-benzodioxol-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)N1CCc2[nH]cnc2C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H20N4O5/c1-29-21(27)14-4-2-3-5-15(14)25-22(28)26-9-8-16-19(24-11-23-16)20(26)13-6-7-17-18(10-13)31-12-30-17/h2-7,10-11,20H,8-9,12H2,1H3,(H,23,24)(H,25,28) |
| InChIKey | USHUQKBPTDIIBN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |