C26H24N4O — CID 29148524
2-[[3-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile (PubChem CID 29148524) has the molecular formula C26H24N4O and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-[[3-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 29148524 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[[3-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile |
| SMILES | COc1ccccc1CN/N=C\c1c(C)n(Cc2ccccc2C#N)c2ccccc12 |
| InChI | InChI=1S/C26H24N4O/c1-19-24(17-29-28-16-21-10-5-8-14-26(21)31-2)23-12-6-7-13-25(23)30(19)18-22-11-4-3-9-20(22)15-27/h3-14,17,28H,16,18H2,1-2H3/b29-17- |
| InChIKey | KOYFWWGMDTUCSZ-RHANQZHGSA-N |
| XLogP | 5.00 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|