C18H24N4OS — CID 29149509
7-[(4-methylsulfanylphenyl)methyl]-3-[(2S)-oxolan-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine (PubChem CID 29149509) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 7-[(4-methylsulfanylphenyl)methyl]-3-[(2S)-oxolan-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine.
| Compound Name | 7-[(4-methylsulfanylphenyl)methyl]-3-[(2S)-oxolan-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
|---|---|
| PubChem CID | 29149509 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 7-[(4-methylsulfanylphenyl)methyl]-3-[(2S)-oxolan-2-yl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
| SMILES | CSc1ccc(CN2CCc3nnc([C@@H]4CCCO4)n3CC2)cc1 |
| InChI | InChI=1S/C18H24N4OS/c1-24-15-6-4-14(5-7-15)13-21-9-8-17-19-20-18(22(17)11-10-21)16-3-2-12-23-16/h4-7,16H,2-3,8-13H2,1H3/t16-/m0/s1 |
| InChIKey | ZWWWZBQYYFRTGK-INIZCTEOSA-N |
| XLogP | 2.91 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |