C20H25ClN2OS — CID 95877254
1-[(4-chlorophenyl)methyl]-4-[[5-[(2S)-oxolan-2-yl]thiophen-2-yl]methyl]piperazine (PubChem CID 95877254) has the molecular formula C20H25ClN2OS and a molecular weight of 376.95 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-4-[[5-[(2S)-oxolan-2-yl]thiophen-2-yl]methyl]piperazine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-4-[[5-[(2S)-oxolan-2-yl]thiophen-2-yl]methyl]piperazine |
|---|---|
| PubChem CID | 95877254 |
| Molecular Formula | C20H25ClN2OS |
| Molecular Weight | 376.95 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-4-[[5-[(2S)-oxolan-2-yl]thiophen-2-yl]methyl]piperazine |
| SMILES | Clc1ccc(CN2CCN(Cc3ccc([C@@H]4CCCO4)s3)CC2)cc1 |
| InChI | InChI=1S/C20H25ClN2OS/c21-17-5-3-16(4-6-17)14-22-9-11-23(12-10-22)15-18-7-8-20(25-18)19-2-1-13-24-19/h3-8,19H,1-2,9-15H2/t19-/m0/s1 |
| InChIKey | SXGNZWYUTFJDJU-IBGZPJMESA-N |
| XLogP | 4.57 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.95 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |