C15H24N2O3S2 — CID 131907476
1-ethylsulfonyl-4-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]piperazine (PubChem CID 131907476) has the molecular formula C15H24N2O3S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]piperazine.
| Compound Name | 1-ethylsulfonyl-4-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]piperazine |
|---|---|
| PubChem CID | 131907476 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-ethylsulfonyl-4-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]piperazine |
| SMILES | CCS(=O)(=O)N1CCN(Cc2ccc(C3CCCO3)s2)CC1 |
| InChI | InChI=1S/C15H24N2O3S2/c1-2-22(18,19)17-9-7-16(8-10-17)12-13-5-6-15(21-13)14-4-3-11-20-14/h5-6,14H,2-4,7-12H2,1H3 |
| InChIKey | PCTPQVIZSRIUNY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |