C15H22N2O4S2 — CID 72923589
5-(oxolan-2-yl)-N-(2-pyrrolidin-1-ylsulfonylethyl)thiophene-2-carboxamide (PubChem CID 72923589) has the molecular formula C15H22N2O4S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 5-(oxolan-2-yl)-N-(2-pyrrolidin-1-ylsulfonylethyl)thiophene-2-carboxamide.
| Compound Name | 5-(oxolan-2-yl)-N-(2-pyrrolidin-1-ylsulfonylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 72923589 |
| Molecular Formula | C15H22N2O4S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 5-(oxolan-2-yl)-N-(2-pyrrolidin-1-ylsulfonylethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)N1CCCC1)c1ccc(C2CCCO2)s1 |
| InChI | InChI=1S/C15H22N2O4S2/c18-15(14-6-5-13(22-14)12-4-3-10-21-12)16-7-11-23(19,20)17-8-1-2-9-17/h5-6,12H,1-4,7-11H2,(H,16,18) |
| InChIKey | QFOIXWIBJKUFML-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |