C18H26N4OS — CID 99951233
1-[(1-methylimidazol-2-yl)methyl]-4-[[5-[(2R)-oxolan-2-yl]thiophen-2-yl]methyl]piperazine (PubChem CID 99951233) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-[(1-methylimidazol-2-yl)methyl]-4-[[5-[(2R)-oxolan-2-yl]thiophen-2-yl]methyl]piperazine.
| Compound Name | 1-[(1-methylimidazol-2-yl)methyl]-4-[[5-[(2R)-oxolan-2-yl]thiophen-2-yl]methyl]piperazine |
|---|---|
| PubChem CID | 99951233 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[(1-methylimidazol-2-yl)methyl]-4-[[5-[(2R)-oxolan-2-yl]thiophen-2-yl]methyl]piperazine |
| SMILES | Cn1ccnc1CN1CCN(Cc2ccc([C@H]3CCCO3)s2)CC1 |
| InChI | InChI=1S/C18H26N4OS/c1-20-7-6-19-18(20)14-22-10-8-21(9-11-22)13-15-4-5-17(24-15)16-3-2-12-23-16/h4-7,16H,2-3,8-14H2,1H3/t16-/m1/s1 |
| InChIKey | MDPDDBHXFQJXSH-MRXNPFEDSA-N |
| XLogP | 2.65 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |