C17H32N4O3S — CID 29149768
N-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-N-methyl-2-piperidin-1-ylethanamine (PubChem CID 29149768) has the molecular formula C17H32N4O3S and a molecular weight of 372.54 g/mol. Its IUPAC name is N-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-N-methyl-2-piperidin-1-ylethanamine.
| Compound Name | N-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-N-methyl-2-piperidin-1-ylethanamine |
|---|---|
| PubChem CID | 29149768 |
| Molecular Formula | C17H32N4O3S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-N-methyl-2-piperidin-1-ylethanamine |
| SMILES | COCCCn1c(CN(C)CCN2CCCCC2)cnc1S(C)(=O)=O |
| InChI | InChI=1S/C17H32N4O3S/c1-19(11-12-20-8-5-4-6-9-20)15-16-14-18-17(25(3,22)23)21(16)10-7-13-24-2/h14H,4-13,15H2,1-3H3 |
| InChIKey | LVGMWEIGUCOYOY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|