C26H32FN3O2S2 — CID 29151496
N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide (PubChem CID 29151496) has the molecular formula C26H32FN3O2S2 and a molecular weight of 501.69 g/mol. Its IUPAC name is N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide.
| Compound Name | N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide |
|---|---|
| PubChem CID | 29151496 |
| Molecular Formula | C26H32FN3O2S2 |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide |
| SMILES | Cc1ccc(C)c2sc(N(CCCN3CCOCC3)C(=O)CCCSc3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C26H32FN3O2S2/c1-19-6-7-20(2)25-24(19)28-26(34-25)30(13-4-12-29-14-16-32-17-15-29)23(31)5-3-18-33-22-10-8-21(27)9-11-22/h6-11H,3-5,12-18H2,1-2H3 |
| InChIKey | YAQCGQDTGCBLCX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|