C25H30ClN3O2S2 — CID 29151512
4-(4-chlorophenyl)sulfanyl-N-(4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)butanamide (PubChem CID 29151512) has the molecular formula C25H30ClN3O2S2 and a molecular weight of 504.12 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-(4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-(4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)butanamide |
|---|---|
| PubChem CID | 29151512 |
| Molecular Formula | C25H30ClN3O2S2 |
| Molecular Weight | 504.12 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-(4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)butanamide |
| SMILES | Cc1cccc2sc(N(CCCN3CCOCC3)C(=O)CCCSc3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C25H30ClN3O2S2/c1-19-5-2-6-22-24(19)27-25(33-22)29(13-4-12-28-14-16-31-17-15-28)23(30)7-3-18-32-21-10-8-20(26)9-11-21/h2,5-6,8-11H,3-4,7,12-18H2,1H3 |
| InChIKey | CEUGWDKDGFPYDQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.12 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|