C24H28Cl3N3O2S2 — CID 44937888
N-(4-chloro-1,3-benzothiazol-2-yl)-4-(4-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide;hydrochloride (PubChem CID 44937888) has the molecular formula C24H28Cl3N3O2S2 and a molecular weight of 561.00 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-2-yl)-4-(4-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide;hydrochloride.
| Compound Name | N-(4-chloro-1,3-benzothiazol-2-yl)-4-(4-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 44937888 |
| Molecular Formula | C24H28Cl3N3O2S2 |
| Molecular Weight | 561.00 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-2-yl)-4-(4-chlorophenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)butanamide;hydrochloride |
| SMILES | Cl.O=C(CCCSc1ccc(Cl)cc1)N(CCCN1CCOCC1)c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C24H27Cl2N3O2S2.ClH/c25-18-7-9-19(10-8-18)32-17-2-6-22(30)29(12-3-11-28-13-15-31-16-14-28)24-27-23-20(26)4-1-5-21(23)33-24;/h1,4-5,7-10H,2-3,6,11-17H2;1H |
| InChIKey | HMPUCDNNVQAJJA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.00 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|