C15H20N8 — CID 29151773
3-[4-[[4-(methylaminomethyl)triazol-1-yl]methyl]piperidin-1-yl]pyrazine-2-carbonitrile (PubChem CID 29151773) has the molecular formula C15H20N8 and a molecular weight of 312.38 g/mol. Its IUPAC name is 3-[4-[[4-(methylaminomethyl)triazol-1-yl]methyl]piperidin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[4-[[4-(methylaminomethyl)triazol-1-yl]methyl]piperidin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 29151773 |
| Molecular Formula | C15H20N8 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3-[4-[[4-(methylaminomethyl)triazol-1-yl]methyl]piperidin-1-yl]pyrazine-2-carbonitrile |
| SMILES | CNCc1cn(CC2CCN(c3nccnc3C#N)CC2)nn1 |
| InChI | InChI=1S/C15H20N8/c1-17-9-13-11-23(21-20-13)10-12-2-6-22(7-3-12)15-14(8-16)18-4-5-19-15/h4-5,11-12,17H,2-3,6-7,9-10H2,1H3 |
| InChIKey | AXPMXLZQHRCPAT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 95.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |