C11H12F3N5O — CID 29152157
N-(2-imidazol-1-ylethyl)-N-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 29152157) has the molecular formula C11H12F3N5O and a molecular weight of 287.25 g/mol. Its IUPAC name is N-(2-imidazol-1-ylethyl)-N-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-imidazol-1-ylethyl)-N-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 29152157 |
| Molecular Formula | C11H12F3N5O |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-(2-imidazol-1-ylethyl)-N-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | CN(CCn1ccnc1)C(=O)c1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C11H12F3N5O/c1-18(4-5-19-3-2-15-7-19)10(20)8-6-9(17-16-8)11(12,13)14/h2-3,6-7H,4-5H2,1H3,(H,16,17) |
| InChIKey | LOVRJSMNVUSWAG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |