C19H22N4O3 — CID 29156541
2-[(4R)-4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclohexylacetamide (PubChem CID 29156541) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[(4R)-4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclohexylacetamide.
| Compound Name | 2-[(4R)-4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 29156541 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[(4R)-4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclohexylacetamide |
| SMILES | C[C@]1(c2ccc(C#N)cc2)NC(=O)N(CC(=O)NC2CCCCC2)C1=O |
| InChI | InChI=1S/C19H22N4O3/c1-19(14-9-7-13(11-20)8-10-14)17(25)23(18(26)22-19)12-16(24)21-15-5-3-2-4-6-15/h7-10,15H,2-6,12H2,1H3,(H,21,24)(H,22,26)/t19-/m1/s1 |
| InChIKey | IATHKGLEKXHLLD-LJQANCHMSA-N |
| XLogP | 1.77 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|