C24H25ClN4O4S — CID 29159759
(E)-N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 29159759) has the molecular formula C24H25ClN4O4S and a molecular weight of 501.01 g/mol. Its IUPAC name is (E)-N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 29159759 |
| Molecular Formula | C24H25ClN4O4S |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | (E)-N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1cc(Cl)cc2sc(N(CCCN3CCOCC3)C(=O)/C=C/c3cccc([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C24H25ClN4O4S/c1-17-14-19(25)16-21-23(17)26-24(34-21)28(9-3-8-27-10-12-33-13-11-27)22(30)7-6-18-4-2-5-20(15-18)29(31)32/h2,4-7,14-16H,3,8-13H2,1H3/b7-6+ |
| InChIKey | CBOLBXACXNFJNG-VOTSOKGWSA-N |
| XLogP | 4.94 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|