C23H23ClN4O4S — CID 74588875
N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 74588875) has the molecular formula C23H23ClN4O4S and a molecular weight of 486.98 g/mol. Its IUPAC name is N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 74588875 |
| Molecular Formula | C23H23ClN4O4S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1cc(Cl)cc2sc(N(CCN3CCOCC3)C(=O)C=Cc3cccc([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C23H23ClN4O4S/c1-16-13-18(24)15-20-22(16)25-23(33-20)27(8-7-26-9-11-32-12-10-26)21(29)6-5-17-3-2-4-19(14-17)28(30)31/h2-6,13-15H,7-12H2,1H3 |
| InChIKey | WOHDSBZZLAEDLA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|