C24H27N3O5 — CID 29160517
ethyl (3R,4S)-4-(3-ethoxyphenyl)-1-(2-methoxyethyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 29160517) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is ethyl (3R,4S)-4-(3-ethoxyphenyl)-1-(2-methoxyethyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl (3R,4S)-4-(3-ethoxyphenyl)-1-(2-methoxyethyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 29160517 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | ethyl (3R,4S)-4-(3-ethoxyphenyl)-1-(2-methoxyethyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)N(CCOC)c2nc3ccccc3n2[C@@H]1c1cccc(OCC)c1 |
| InChI | InChI=1S/C24H27N3O5/c1-4-31-17-10-8-9-16(15-17)21-20(23(29)32-5-2)22(28)26(13-14-30-3)24-25-18-11-6-7-12-19(18)27(21)24/h6-12,15,20-21H,4-5,13-14H2,1-3H3/t20-,21-/m1/s1 |
| InChIKey | CLZHEBICJGAUHY-NHCUHLMSSA-N |
| XLogP | 3.20 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|