C30H31N3O4 — CID 16653686
ethyl 2-oxo-1-pentyl-4-(3-phenoxyphenyl)-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 16653686) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is ethyl 2-oxo-1-pentyl-4-(3-phenoxyphenyl)-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl 2-oxo-1-pentyl-4-(3-phenoxyphenyl)-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 16653686 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | ethyl 2-oxo-1-pentyl-4-(3-phenoxyphenyl)-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCCCCN1C(=O)C(C(=O)OCC)C(c2cccc(Oc3ccccc3)c2)n2c1nc1ccccc12 |
| InChI | InChI=1S/C30H31N3O4/c1-3-5-11-19-32-28(34)26(29(35)36-4-2)27(33-25-18-10-9-17-24(25)31-30(32)33)21-13-12-16-23(20-21)37-22-14-7-6-8-15-22/h6-10,12-18,20,26-27H,3-5,11,19H2,1-2H3 |
| InChIKey | RMEQXVNEJWKDDZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|