C24H26FN3O3 — CID 29111014
ethyl (3R,4R)-4-(3-fluorophenyl)-2-oxo-1-pentyl-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 29111014) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is ethyl (3R,4R)-4-(3-fluorophenyl)-2-oxo-1-pentyl-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl (3R,4R)-4-(3-fluorophenyl)-2-oxo-1-pentyl-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 29111014 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | ethyl (3R,4R)-4-(3-fluorophenyl)-2-oxo-1-pentyl-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCCCCN1C(=O)[C@H](C(=O)OCC)[C@H](c2cccc(F)c2)n2c1nc1ccccc12 |
| InChI | InChI=1S/C24H26FN3O3/c1-3-5-8-14-27-22(29)20(23(30)31-4-2)21(16-10-9-11-17(25)15-16)28-19-13-7-6-12-18(19)26-24(27)28/h6-7,9-13,15,20-21H,3-5,8,14H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | SHCVKGTUSAANOJ-RTWAWAEBSA-N |
| XLogP | 4.48 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|