C24H26N4O5 — CID 29160820
ethyl (3S,4S)-1-(3-methylbutyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 29160820) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is ethyl (3S,4S)-1-(3-methylbutyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl (3S,4S)-1-(3-methylbutyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 29160820 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | ethyl (3S,4S)-1-(3-methylbutyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N(CCC(C)C)c2nc3ccccc3n2[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H26N4O5/c1-4-33-23(30)20-21(16-8-7-9-17(14-16)28(31)32)27-19-11-6-5-10-18(19)25-24(27)26(22(20)29)13-12-15(2)3/h5-11,14-15,20-21H,4,12-13H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | DUDJDQYNGYYXQC-LEWJYISDSA-N |
| XLogP | 4.11 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|