C27H22N2O4S — CID 2916107
2-[N-(benzenesulfonyl)-3-methylanilino]-N-dibenzofuran-3-ylacetamide (PubChem CID 2916107) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-methylanilino]-N-dibenzofuran-3-ylacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-methylanilino]-N-dibenzofuran-3-ylacetamide |
|---|---|
| PubChem CID | 2916107 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-methylanilino]-N-dibenzofuran-3-ylacetamide |
| SMILES | Cc1cccc(N(CC(=O)Nc2ccc3c(c2)oc2ccccc23)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H22N2O4S/c1-19-8-7-9-21(16-19)29(34(31,32)22-10-3-2-4-11-22)18-27(30)28-20-14-15-24-23-12-5-6-13-25(23)33-26(24)17-20/h2-17H,18H2,1H3,(H,28,30) |
| InChIKey | JAXNXAZZRZLPOL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |