About 3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine
3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine (PubChem CID 29179072) has the molecular formula C6H12N4S
and a molecular weight of 172.26 g/mol. Its IUPAC name is 3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine.
Analyze 3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine?
The IUPAC name of 3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine (CID 29179072) is 3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine.
What is the SMILES notation for 3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine?
The canonical SMILES for 3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine is Cc1nnc(SC(C)C)n1N.
What is the InChIKey of 3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine?
The InChIKey is OVVPPNILSAKXAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4S/c1-4(2)11-6-9-8-5(3)10(6)7/h4H,7H2,1-3H3.
What are the key properties of 3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine?
3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine has a molecular weight of 172.26 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-propan-2-ylsulfanyl-1,2,4-triazol-4-amine is sourced from PubChem (CID 29179072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).