C12H12F3N5OS — CID 7845228
(2R)-2-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 7845228) has the molecular formula C12H12F3N5OS and a molecular weight of 331.32 g/mol. Its IUPAC name is (2R)-2-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 7845228 |
| Molecular Formula | C12H12F3N5OS |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (2R)-2-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | Cc1nnc(S[C@H](C)C(=O)Nc2ccc(F)c(F)c2F)n1N |
| InChI | InChI=1S/C12H12F3N5OS/c1-5(22-12-19-18-6(2)20(12)16)11(21)17-8-4-3-7(13)9(14)10(8)15/h3-5H,16H2,1-2H3,(H,17,21)/t5-/m1/s1 |
| InChIKey | KVYVXFVGAXHDOU-RXMQYKEDSA-N |
| XLogP | 1.84 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|