C18H22F3N3OS — CID 40518428
(2R)-2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 40518428) has the molecular formula C18H22F3N3OS and a molecular weight of 385.46 g/mol. Its IUPAC name is (2R)-2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 40518428 |
| Molecular Formula | C18H22F3N3OS |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (2R)-2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | Cc1nc(S[C@H](C)C(=O)Nc2ccc(F)c(F)c2F)n(CC(C)C)c1C |
| InChI | InChI=1S/C18H22F3N3OS/c1-9(2)8-24-11(4)10(3)22-18(24)26-12(5)17(25)23-14-7-6-13(19)15(20)16(14)21/h6-7,9,12H,8H2,1-5H3,(H,23,25)/t12-/m1/s1 |
| InChIKey | MRNWBOMUVKWLGK-GFCCVEGCSA-N |
| XLogP | 4.69 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|